palmitoleic acid

Từ điển mở Wiktionary
Bước tới điều hướng Bước tới tìm kiếm

Tiếng Anh[sửa]

Danh từ[sửa]

palmitoleic acid ((9Z)-hexadec-9-enoic acid) (không đếm được)

  1. (hóa học hữu cơ) Một axit béo không bão hòa, có 16 carbon nguyên tử và một liên kết đôi, tìm thấy trong các mô mỡ của tất cả các loài động vật, có công thức hóa học là CH3(CH2)5CH=CH(CH2)7COOH.

Đồng nghĩa[sửa]